C28H31N7O — CID 163554400
N-[3-(dimethylamino)propyl]-4-[2-methyl-3-(quinolin-6-ylmethyl)-1H-triazolo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 163554400) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[2-methyl-3-(quinolin-6-ylmethyl)-1H-triazolo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[2-methyl-3-(quinolin-6-ylmethyl)-1H-triazolo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 163554400 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[2-methyl-3-(quinolin-6-ylmethyl)-1H-triazolo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2ccc3c(n2)N(Cc2ccc4ncccc4c2)N(C)N3)cc1 |
| InChI | InChI=1S/C28H31N7O/c1-33(2)17-5-16-30-28(36)22-10-8-21(9-11-22)25-13-14-26-27(31-25)35(34(3)32-26)19-20-7-12-24-23(18-20)6-4-15-29-24/h4,6-15,18,32H,5,16-17,19H2,1-3H3,(H,30,36) |
| InChIKey | FLTVQMROOOREHK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|