C21H19N9O — CID 139321257
2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-N-methylpyridine-4-carboxamide (PubChem CID 139321257) has the molecular formula C21H19N9O and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 139321257 |
| Molecular Formula | C21H19N9O |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-N-methylpyridine-4-carboxamide |
| SMILES | [H]/N=N/c1ncc(Nc2cc(C(=O)NC)ccn2)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H19N9O/c1-23-21(31)15-6-8-25-17(10-15)28-18-12-27-20(30-22)19(29-18)26-11-13-4-5-16-14(9-13)3-2-7-24-16/h2-10,12,22H,11H2,1H3,(H,23,31)(H2,25,26,28,29)/b30-22+ |
| InChIKey | OXGAGKGUAIFVAP-JBASAIQMSA-N |
| XLogP | 3.80 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|