C21H21N7O2 — CID 139321348
2-[[2-[[5-amino-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-4-pyridinyl]oxy]ethanol (PubChem CID 139321348) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-[[2-[[5-amino-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-4-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[2-[[5-amino-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-4-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 139321348 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[[2-[[5-amino-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-4-pyridinyl]oxy]ethanol |
| SMILES | Nc1ncc(Nc2cc(OCCO)ccn2)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H21N7O2/c22-20-21(26-12-14-3-4-17-15(10-14)2-1-6-23-17)28-19(13-25-20)27-18-11-16(5-7-24-18)30-9-8-29/h1-7,10-11,13,29H,8-9,12H2,(H2,22,25)(H2,24,26,27,28) |
| InChIKey | SZEYTFGOOBBUSS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |