C23H25N9O2 — CID 123917924
4-[[4-[[5-hydrazinyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-2-pyridinyl]amino]oxolan-3-ol (PubChem CID 123917924) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-[[4-[[5-hydrazinyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-2-pyridinyl]amino]oxolan-3-ol.
| Compound Name | 4-[[4-[[5-hydrazinyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-2-pyridinyl]amino]oxolan-3-ol |
|---|---|
| PubChem CID | 123917924 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[[4-[[5-hydrazinyl-6-(quinolin-6-ylmethylamino)pyrazin-2-yl]amino]-2-pyridinyl]amino]oxolan-3-ol |
| SMILES | NNc1ncc(Nc2ccnc(NC3COCC3O)c2)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H25N9O2/c24-32-23-22(27-10-14-3-4-17-15(8-14)2-1-6-25-17)31-21(11-28-23)29-16-5-7-26-20(9-16)30-18-12-34-13-19(18)33/h1-9,11,18-19,33H,10,12-13,24H2,(H,28,32)(H3,26,27,29,30,31) |
| InChIKey | HBSIMLBNAFHCFW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|