C22H24N8O — CID 139321354
5-N-[4-(2-methoxyethylamino)-2-pyridinyl]-3-N-(quinolin-6-ylmethyl)pyrazine-2,3,5-triamine (PubChem CID 139321354) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 5-N-[4-(2-methoxyethylamino)-2-pyridinyl]-3-N-(quinolin-6-ylmethyl)pyrazine-2,3,5-triamine.
| Compound Name | 5-N-[4-(2-methoxyethylamino)-2-pyridinyl]-3-N-(quinolin-6-ylmethyl)pyrazine-2,3,5-triamine |
|---|---|
| PubChem CID | 139321354 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 5-N-[4-(2-methoxyethylamino)-2-pyridinyl]-3-N-(quinolin-6-ylmethyl)pyrazine-2,3,5-triamine |
| SMILES | COCCNc1ccnc(Nc2cnc(N)c(NCc3ccc4ncccc4c3)n2)c1 |
| InChI | InChI=1S/C22H24N8O/c1-31-10-9-24-17-6-8-26-19(12-17)29-20-14-27-21(23)22(30-20)28-13-15-4-5-18-16(11-15)3-2-7-25-18/h2-8,11-12,14H,9-10,13H2,1H3,(H2,23,27)(H3,24,26,28,29,30) |
| InChIKey | LJBSMOQHLDORCI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|