C25H23ClN6O2 — CID 123460431
2-chloro-N-propoxy-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 123460431) has the molecular formula C25H23ClN6O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2-chloro-N-propoxy-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | 2-chloro-N-propoxy-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 123460431 |
| Molecular Formula | C25H23ClN6O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-chloro-N-propoxy-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CCCONC(=O)c1ccc(-c2ccc3c(n2)N(Cc2ccc4ncccc4c2)NN3)cc1Cl |
| InChI | InChI=1S/C25H23ClN6O2/c1-2-12-34-30-25(33)19-7-6-18(14-20(19)26)22-9-10-23-24(28-22)32(31-29-23)15-16-5-8-21-17(13-16)4-3-11-27-21/h3-11,13-14,29,31H,2,12,15H2,1H3,(H,30,33) |
| InChIKey | FGGMIGSIDMKBNT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|