C25H23ClN6O3 — CID 123181910
2-chloro-N-(2-hydroxypropoxy)-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 123181910) has the molecular formula C25H23ClN6O3 and a molecular weight of 490.95 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxypropoxy)-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | 2-chloro-N-(2-hydroxypropoxy)-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 123181910 |
| Molecular Formula | C25H23ClN6O3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-chloro-N-(2-hydroxypropoxy)-4-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CC(O)CONC(=O)c1ccc(-c2ccc3c(n2)N(Cc2ccc4ncccc4c2)NN3)cc1Cl |
| InChI | InChI=1S/C25H23ClN6O3/c1-15(33)14-35-30-25(34)19-6-5-18(12-20(19)26)22-8-9-23-24(28-22)32(31-29-23)13-16-4-7-21-17(11-16)3-2-10-27-21/h2-12,15,29,31,33H,13-14H2,1H3,(H,30,34) |
| InChIKey | WMGQQVDMBAFCIJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|