C20H15N5OS — CID 118214051
5-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophene-2-carbaldehyde (PubChem CID 118214051) has the molecular formula C20H15N5OS and a molecular weight of 373.44 g/mol. Its IUPAC name is 5-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 118214051 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-[3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyridin-5-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c(n2)N(Cc2ccc4ncccc4c2)NN3)s1 |
| InChI | InChI=1S/C20H15N5OS/c26-12-15-4-8-19(27-15)17-6-7-18-20(22-17)25(24-23-18)11-13-3-5-16-14(10-13)2-1-9-21-16/h1-10,12,23-24H,11H2 |
| InChIKey | SVJQRWRAKGUZNZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|