C22H21N7O2 — CID 123512905
N-[2-(2-methoxyethoxy)-3-pyridinyl]-8-(quinolin-6-ylmethyl)-2,5,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-amine (PubChem CID 123512905) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-3-pyridinyl]-8-(quinolin-6-ylmethyl)-2,5,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-amine.
| Compound Name | N-[2-(2-methoxyethoxy)-3-pyridinyl]-8-(quinolin-6-ylmethyl)-2,5,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 123512905 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-3-pyridinyl]-8-(quinolin-6-ylmethyl)-2,5,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-amine |
| SMILES | COCCOc1ncccc1Nc1cnc2[nH]n(Cc3ccc4ncccc4c3)c2n1 |
| InChI | InChI=1S/C22H21N7O2/c1-30-10-11-31-22-18(5-3-9-24-22)26-19-13-25-20-21(27-19)29(28-20)14-15-6-7-17-16(12-15)4-2-8-23-17/h2-9,12-13H,10-11,14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | JWPKSTVRYTXTRW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|