C18H15ClIN5O — CID 89053755
3-amino-N-[3-[[(2-chloro-5-iodopyrimidin-4-yl)amino]methyl]phenyl]benzamide (PubChem CID 89053755) has the molecular formula C18H15ClIN5O and a molecular weight of 479.71 g/mol. Its IUPAC name is 3-amino-N-[3-[[(2-chloro-5-iodopyrimidin-4-yl)amino]methyl]phenyl]benzamide.
| Compound Name | 3-amino-N-[3-[[(2-chloro-5-iodopyrimidin-4-yl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 89053755 |
| Molecular Formula | C18H15ClIN5O |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 3-amino-N-[3-[[(2-chloro-5-iodopyrimidin-4-yl)amino]methyl]phenyl]benzamide |
| SMILES | Nc1cccc(C(=O)Nc2cccc(CNc3nc(Cl)ncc3I)c2)c1 |
| InChI | InChI=1S/C18H15ClIN5O/c19-18-23-10-15(20)16(25-18)22-9-11-3-1-6-14(7-11)24-17(26)12-4-2-5-13(21)8-12/h1-8,10H,9,21H2,(H,24,26)(H,22,23,25) |
| InChIKey | ZSFXXDFJQQDITF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|