C22H16F2N4O — CID 78901220
3-fluoro-N-[3-[[(5-fluoroquinazolin-4-yl)amino]methyl]phenyl]benzamide (PubChem CID 78901220) has the molecular formula C22H16F2N4O and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-fluoro-N-[3-[[(5-fluoroquinazolin-4-yl)amino]methyl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[3-[[(5-fluoroquinazolin-4-yl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 78901220 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-fluoro-N-[3-[[(5-fluoroquinazolin-4-yl)amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CNc2ncnc3cccc(F)c23)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H16F2N4O/c23-16-6-2-5-15(11-16)22(29)28-17-7-1-4-14(10-17)12-25-21-20-18(24)8-3-9-19(20)26-13-27-21/h1-11,13H,12H2,(H,28,29)(H,25,26,27) |
| InChIKey | UMXUKOSNRHYKIH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |