C21H19FN4O — CID 133297956
N-[3-[[(2-cyclopropylpyrimidin-4-yl)amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 133297956) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[3-[[(2-cyclopropylpyrimidin-4-yl)amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[(2-cyclopropylpyrimidin-4-yl)amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 133297956 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[3-[[(2-cyclopropylpyrimidin-4-yl)amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1cccc(CNc2ccnc(C3CC3)n2)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H19FN4O/c22-17-5-2-4-16(12-17)21(27)25-18-6-1-3-14(11-18)13-24-19-9-10-23-20(26-19)15-7-8-15/h1-6,9-12,15H,7-8,13H2,(H,25,27)(H,23,24,26) |
| InChIKey | PRFWVYZCBRNDJF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |