C12H13FN4O — CID 113432130
N-[2-(3-aminophenoxy)ethyl]-5-fluoropyrimidin-2-amine (PubChem CID 113432130) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is N-[2-(3-aminophenoxy)ethyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[2-(3-aminophenoxy)ethyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 113432130 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[2-(3-aminophenoxy)ethyl]-5-fluoropyrimidin-2-amine |
| SMILES | Nc1cccc(OCCNc2ncc(F)cn2)c1 |
| InChI | InChI=1S/C12H13FN4O/c13-9-7-16-12(17-8-9)15-4-5-18-11-3-1-2-10(14)6-11/h1-3,6-8H,4-5,14H2,(H,15,16,17) |
| InChIKey | PMOMTWLWELUJGV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|