C12H13FN4O — CID 117224521
N'-[5-(3-fluorophenoxy)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 117224521) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is N'-[5-(3-fluorophenoxy)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[5-(3-fluorophenoxy)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117224521 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N'-[5-(3-fluorophenoxy)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | NCCNc1ncc(Oc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C12H13FN4O/c13-9-2-1-3-10(6-9)18-11-7-16-12(17-8-11)15-5-4-14/h1-3,6-8H,4-5,14H2,(H,15,16,17) |
| InChIKey | RDRGFBBUJMZLAZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |