C13H15FN4O2 — CID 80869841
4-(3-fluorophenoxy)-6-methoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80869841) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-6-methoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-fluorophenoxy)-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80869841 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-(3-fluorophenoxy)-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OC)nc(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H15FN4O2/c1-3-7-15-11-16-12(19-2)18-13(17-11)20-10-6-4-5-9(14)8-10/h4-6,8H,3,7H2,1-2H3,(H,15,16,17,18) |
| InChIKey | PSGFJJJXZOYNEO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |