C14H17FN4O2 — CID 80865729
4-ethoxy-6-(4-fluorophenoxy)-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80865729) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 4-ethoxy-6-(4-fluorophenoxy)-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(4-fluorophenoxy)-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80865729 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-ethoxy-6-(4-fluorophenoxy)-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OCC)nc(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H17FN4O2/c1-3-9-16-12-17-13(20-4-2)19-14(18-12)21-11-7-5-10(15)6-8-11/h5-8H,3-4,9H2,1-2H3,(H,16,17,18,19) |
| InChIKey | FAZFPTVPBYKZLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |