C14H16ClFN4O — CID 115505060
4-(2-chloro-4-fluorophenyl)-6-ethoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 115505060) has the molecular formula C14H16ClFN4O and a molecular weight of 310.76 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-6-ethoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-6-ethoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115505060 |
| Molecular Formula | C14H16ClFN4O |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-6-ethoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OCC)nc(-c2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C14H16ClFN4O/c1-3-7-17-13-18-12(19-14(20-13)21-4-2)10-6-5-9(16)8-11(10)15/h5-6,8H,3-4,7H2,1-2H3,(H,17,18,19,20) |
| InChIKey | LKKHHOGCJBIWOQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |