C13H13BrClFN4O — CID 106763667
4-(4-bromo-3-chloro-2-fluorophenyl)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 106763667) has the molecular formula C13H13BrClFN4O and a molecular weight of 375.63 g/mol. Its IUPAC name is 4-(4-bromo-3-chloro-2-fluorophenyl)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-bromo-3-chloro-2-fluorophenyl)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106763667 |
| Molecular Formula | C13H13BrClFN4O |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 4-(4-bromo-3-chloro-2-fluorophenyl)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(-c2ccc(Br)c(Cl)c2F)n1 |
| InChI | InChI=1S/C13H13BrClFN4O/c1-3-17-12-18-11(19-13(20-12)21-4-2)7-5-6-8(14)9(15)10(7)16/h5-6H,3-4H2,1-2H3,(H,17,18,19,20) |
| InChIKey | YABSPGRQSLJBHR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|