C13H14BrFN4O2 — CID 81314804
4-(3-bromo-5-fluorophenoxy)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 81314804) has the molecular formula C13H14BrFN4O2 and a molecular weight of 357.18 g/mol. Its IUPAC name is 4-(3-bromo-5-fluorophenoxy)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-bromo-5-fluorophenoxy)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 81314804 |
| Molecular Formula | C13H14BrFN4O2 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 4-(3-bromo-5-fluorophenoxy)-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(Oc2cc(F)cc(Br)c2)n1 |
| InChI | InChI=1S/C13H14BrFN4O2/c1-3-16-11-17-12(20-4-2)19-13(18-11)21-10-6-8(14)5-9(15)7-10/h5-7H,3-4H2,1-2H3,(H,16,17,18,19) |
| InChIKey | UFTPABJILKJRBR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |