C13H15ClN4OS — CID 80887574
4-(4-chlorophenyl)sulfanyl-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 80887574) has the molecular formula C13H15ClN4OS and a molecular weight of 310.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80887574 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-ethoxy-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(Sc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H15ClN4OS/c1-3-15-11-16-12(19-4-2)18-13(17-11)20-10-7-5-9(14)6-8-10/h5-8H,3-4H2,1-2H3,(H,15,16,17,18) |
| InChIKey | AYOHTEWOJPTOSX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |