C12H12ClN3O2S — CID 62859230
2-chloro-4-ethoxy-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine (PubChem CID 62859230) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 62859230 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-chloro-4-ethoxy-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(Sc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-3-18-11-14-10(13)15-12(16-11)19-9-6-4-8(17-2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | UMBSGVWMFGESFJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |