C15H19N3O2S — CID 58339649
N-[(4-methoxyphenyl)methyl]-5-(2-methylsulfanylethoxy)pyrimidin-2-amine (PubChem CID 58339649) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-(2-methylsulfanylethoxy)pyrimidin-2-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-(2-methylsulfanylethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58339649 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-(2-methylsulfanylethoxy)pyrimidin-2-amine |
| SMILES | COc1ccc(CNc2ncc(OCCSC)cn2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-19-13-5-3-12(4-6-13)9-16-15-17-10-14(11-18-15)20-7-8-21-2/h3-6,10-11H,7-9H2,1-2H3,(H,16,17,18) |
| InChIKey | DHQKFCWQNZZCDS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|