C15H16F3N3OS — CID 71738710
5-(2-methylsulfanylethoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine (PubChem CID 71738710) has the molecular formula C15H16F3N3OS and a molecular weight of 343.37 g/mol. Its IUPAC name is 5-(2-methylsulfanylethoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine.
| Compound Name | 5-(2-methylsulfanylethoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71738710 |
| Molecular Formula | C15H16F3N3OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-(2-methylsulfanylethoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine |
| SMILES | CSCCOc1cnc(NCc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C15H16F3N3OS/c1-23-6-5-22-13-9-20-14(21-10-13)19-8-11-3-2-4-12(7-11)15(16,17)18/h2-4,7,9-10H,5-6,8H2,1H3,(H,19,20,21) |
| InChIKey | RZRKANRAFAMZMK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|