C22H30N8O2 — CID 143193128
(2S)-6-[[4,6-bis(3-aminoanilino)-1,3,5-triazin-2-yl]-methylamino]hexane-1,2-diol (PubChem CID 143193128) has the molecular formula C22H30N8O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is (2S)-6-[[4,6-bis(3-aminoanilino)-1,3,5-triazin-2-yl]-methylamino]hexane-1,2-diol.
| Compound Name | (2S)-6-[[4,6-bis(3-aminoanilino)-1,3,5-triazin-2-yl]-methylamino]hexane-1,2-diol |
|---|---|
| PubChem CID | 143193128 |
| Molecular Formula | C22H30N8O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2S)-6-[[4,6-bis(3-aminoanilino)-1,3,5-triazin-2-yl]-methylamino]hexane-1,2-diol |
| SMILES | CN(CCCC[C@H](O)CO)c1nc(Nc2cccc(N)c2)nc(Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C22H30N8O2/c1-30(11-3-2-10-19(32)14-31)22-28-20(25-17-8-4-6-15(23)12-17)27-21(29-22)26-18-9-5-7-16(24)13-18/h4-9,12-13,19,31-32H,2-3,10-11,14,23-24H2,1H3,(H2,25,26,27,28,29)/t19-/m0/s1 |
| InChIKey | ISQRBBXVSCHSNN-IBGZPJMESA-N |
| XLogP | 2.48 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|