C11H14N6O — CID 90254949
3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 90254949) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 90254949 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CN(C)c1nc(N)nc(Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C11H14N6O/c1-17(2)11-15-9(12)14-10(16-11)13-7-4-3-5-8(18)6-7/h3-6,18H,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | DQMCJJSRTKPZMA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |