C9H10N6S — CID 167276914
3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzenethiol (PubChem CID 167276914) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzenethiol.
| Compound Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzenethiol |
|---|---|
| PubChem CID | 167276914 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzenethiol |
| SMILES | Nc1nc(N)nc(Nc2cccc(S)c2)n1 |
| InChI | InChI=1S/C9H10N6S/c10-7-13-8(11)15-9(14-7)12-5-2-1-3-6(16)4-5/h1-4,16H,(H5,10,11,12,13,14,15) |
| InChIKey | KIRMMUZFEOUMCO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|