C11H12Cl2N6 — CID 80847427
4-N-(2,6-dichlorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80847427) has the molecular formula C11H12Cl2N6 and a molecular weight of 299.17 g/mol. Its IUPAC name is 4-N-(2,6-dichlorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,6-dichlorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80847427 |
| Molecular Formula | C11H12Cl2N6 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-N-(2,6-dichlorophenyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(Nc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C11H12Cl2N6/c1-19(2)11-17-9(14)16-10(18-11)15-8-6(12)4-3-5-7(8)13/h3-5H,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | PBXCRBSALITCIY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |