C35H28N8 — CID 90388781
4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dinaphthalen-1-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90388781) has the molecular formula C35H28N8 and a molecular weight of 560.67 g/mol. Its IUPAC name is 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dinaphthalen-1-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dinaphthalen-1-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90388781 |
| Molecular Formula | C35H28N8 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dinaphthalen-1-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1cccc(Nc2nc(Nc3cccc(N)c3)nc(N(c3cccc4ccccc34)c3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C35H28N8/c36-25-13-7-15-27(21-25)38-33-40-34(39-28-16-8-14-26(37)22-28)42-35(41-33)43(31-19-5-11-23-9-1-3-17-29(23)31)32-20-6-12-24-10-2-4-18-30(24)32/h1-22H,36-37H2,(H2,38,39,40,41,42) |
| InChIKey | PMVMLJXKYNYFJJ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|