C18H12F3N5O — CID 85470488
9-phenyl-N-[4-(trifluoromethoxy)phenyl]purin-2-amine (PubChem CID 85470488) has the molecular formula C18H12F3N5O and a molecular weight of 371.32 g/mol. Its IUPAC name is 9-phenyl-N-[4-(trifluoromethoxy)phenyl]purin-2-amine.
| Compound Name | 9-phenyl-N-[4-(trifluoromethoxy)phenyl]purin-2-amine |
|---|---|
| PubChem CID | 85470488 |
| Molecular Formula | C18H12F3N5O |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 9-phenyl-N-[4-(trifluoromethoxy)phenyl]purin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2ncc3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C18H12F3N5O/c19-18(20,21)27-14-8-6-12(7-9-14)24-17-22-10-15-16(25-17)26(11-23-15)13-4-2-1-3-5-13/h1-11H,(H,22,24,25) |
| InChIKey | CLFMGIRGSGDCDZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |