C19H13F3N4O — CID 68524977
9-(4-phenylmethoxyphenyl)-2-(trifluoromethyl)purine (PubChem CID 68524977) has the molecular formula C19H13F3N4O and a molecular weight of 370.33 g/mol. Its IUPAC name is 9-(4-phenylmethoxyphenyl)-2-(trifluoromethyl)purine.
| Compound Name | 9-(4-phenylmethoxyphenyl)-2-(trifluoromethyl)purine |
|---|---|
| PubChem CID | 68524977 |
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 9-(4-phenylmethoxyphenyl)-2-(trifluoromethyl)purine |
| SMILES | FC(F)(F)c1ncc2ncn(-c3ccc(OCc4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C19H13F3N4O/c20-19(21,22)18-23-10-16-17(25-18)26(12-24-16)14-6-8-15(9-7-14)27-11-13-4-2-1-3-5-13/h1-10,12H,11H2 |
| InChIKey | GDCQVGXDVVYZLL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |