C24H21F3N4O4 — CID 11465893
N-(2-methoxyethyl)-3-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 11465893) has the molecular formula C24H21F3N4O4 and a molecular weight of 486.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 11465893 |
| Molecular Formula | C24H21F3N4O4 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-(2-methoxyethyl)-3-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | COCCNC(=O)c1cnc2c(c1)ncn2-c1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H21F3N4O4/c1-33-11-10-28-23(32)17-12-21-22(29-13-17)31(15-30-21)18-4-8-19(9-5-18)34-14-16-2-6-20(7-3-16)35-24(25,26)27/h2-9,12-13,15H,10-11,14H2,1H3,(H,28,32) |
| InChIKey | GPNDCMNBOFMJHV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|