C30H32F3N5O3 — CID 11273057
N-[3-(4-methylpiperazin-1-yl)propyl]-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide (PubChem CID 11273057) has the molecular formula C30H32F3N5O3 and a molecular weight of 567.61 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11273057 |
| Molecular Formula | C30H32F3N5O3 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc3c(c2)ncn3-c2ccc(OCc3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H32F3N5O3/c1-36-15-17-37(18-16-36)14-2-13-34-29(39)23-5-12-28-27(19-23)35-21-38(28)24-6-10-25(11-7-24)40-20-22-3-8-26(9-4-22)41-30(31,32)33/h3-12,19,21H,2,13-18,20H2,1H3,(H,34,39) |
| InChIKey | YVFANVPCNQVLAC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|