C26H21N3O3 — CID 4546936
N-(furan-2-ylmethyl)-1-(4-phenylmethoxyphenyl)benzimidazole-5-carboxamide (PubChem CID 4546936) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(4-phenylmethoxyphenyl)benzimidazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-(4-phenylmethoxyphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 4546936 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(4-phenylmethoxyphenyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc2c(c1)ncn2-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3/c30-26(27-16-23-7-4-14-31-23)20-8-13-25-24(15-20)28-18-29(25)21-9-11-22(12-10-21)32-17-19-5-2-1-3-6-19/h1-15,18H,16-17H2,(H,27,30) |
| InChIKey | ZNCBPQFVDVWFSP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |