C29H26N4O2 — CID 11259761
1-[3-(3-phenylpropoxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 11259761) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[3-(3-phenylpropoxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[3-(3-phenylpropoxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11259761 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-[3-(3-phenylpropoxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2c(c1)ncn2-c1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C29H26N4O2/c34-29(31-20-23-9-5-15-30-19-23)24-13-14-28-27(17-24)32-21-33(28)25-11-4-12-26(18-25)35-16-6-10-22-7-2-1-3-8-22/h1-5,7-9,11-15,17-19,21H,6,10,16,20H2,(H,31,34) |
| InChIKey | UOKOXPRQVUAXSM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|