C29H23F3N4O4 — CID 67011613
N-(pyridin-3-ylmethyl)-1-[4-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]phenyl]benzimidazole-5-carboxamide (PubChem CID 67011613) has the molecular formula C29H23F3N4O4 and a molecular weight of 548.52 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1-[4-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]phenyl]benzimidazole-5-carboxamide.
| Compound Name | N-(pyridin-3-ylmethyl)-1-[4-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]phenyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67011613 |
| Molecular Formula | C29H23F3N4O4 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1-[4-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]phenyl]benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2c(c1)ncn2-c1ccc(OCCOc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H23F3N4O4/c30-29(31,32)40-27-6-2-1-5-26(27)39-15-14-38-23-10-8-22(9-11-23)36-19-35-24-16-21(7-12-25(24)36)28(37)34-18-20-4-3-13-33-17-20/h1-13,16-17,19H,14-15,18H2,(H,34,37) |
| InChIKey | OCMZUDNIFRWBHN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|