C28H30N4O4 — CID 69069769
ethyl 4-[4-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenoxy]hexanoate (PubChem CID 69069769) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 4-[4-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenoxy]hexanoate.
| Compound Name | ethyl 4-[4-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 69069769 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 4-[4-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCC(CC)Oc1ccc(-n2cnc3cc(C(=O)NCc4cccnc4)ccc32)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-3-23(12-14-27(33)35-4-2)36-24-10-8-22(9-11-24)32-19-31-25-16-21(7-13-26(25)32)28(34)30-18-20-6-5-15-29-17-20/h5-11,13,15-17,19,23H,3-4,12,14,18H2,1-2H3,(H,30,34) |
| InChIKey | VEZQORBINKTZDE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |