C28H24N4O2 — CID 11751247
1-[4-[(4-methylphenyl)methoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 11751247) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[4-[(4-methylphenyl)methoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[4-[(4-methylphenyl)methoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11751247 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-[4-[(4-methylphenyl)methoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(COc2ccc(-n3cnc4cc(C(=O)NCc5cccnc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C28H24N4O2/c1-20-4-6-21(7-5-20)18-34-25-11-9-24(10-12-25)32-19-31-26-15-23(8-13-27(26)32)28(33)30-17-22-3-2-14-29-16-22/h2-16,19H,17-18H2,1H3,(H,30,33) |
| InChIKey | RJZZFGXTKXFWBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |