C30H28N4O4 — CID 67012284
1-[4-[3-(4-methoxyphenoxy)propoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 67012284) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 1-[4-[3-(4-methoxyphenoxy)propoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[4-[3-(4-methoxyphenoxy)propoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67012284 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-[4-[3-(4-methoxyphenoxy)propoxy]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | COc1ccc(OCCCOc2ccc(-n3cnc4cc(C(=O)NCc5cccnc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C30H28N4O4/c1-36-25-10-12-27(13-11-25)38-17-3-16-37-26-8-6-24(7-9-26)34-21-33-28-18-23(5-14-29(28)34)30(35)32-20-22-4-2-15-31-19-22/h2,4-15,18-19,21H,3,16-17,20H2,1H3,(H,32,35) |
| InChIKey | JVAYURVLMLDNSP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|