C27H28ClN5O — CID 143011539
1-[3-[(4-chlorocyclohexyl)methylamino]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 143011539) has the molecular formula C27H28ClN5O and a molecular weight of 474.01 g/mol. Its IUPAC name is 1-[3-[(4-chlorocyclohexyl)methylamino]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[3-[(4-chlorocyclohexyl)methylamino]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143011539 |
| Molecular Formula | C27H28ClN5O |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[3-[(4-chlorocyclohexyl)methylamino]phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2c(c1)ncn2-c1cccc(NCC2CCC(Cl)CC2)c1 |
| InChI | InChI=1S/C27H28ClN5O/c28-22-9-6-19(7-10-22)16-30-23-4-1-5-24(14-23)33-18-32-25-13-21(8-11-26(25)33)27(34)31-17-20-3-2-12-29-15-20/h1-5,8,11-15,18-19,22,30H,6-7,9-10,16-17H2,(H,31,34) |
| InChIKey | OWDWQAOWNYOCHO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|