C24H21N3O3 — CID 109169297
N-(furan-2-ylmethyl)-2-(4-phenylmethoxyanilino)pyridine-4-carboxamide (PubChem CID 109169297) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-phenylmethoxyanilino)pyridine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-phenylmethoxyanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109169297 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-phenylmethoxyanilino)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccnc(Nc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H21N3O3/c28-24(26-16-22-7-4-14-29-22)19-12-13-25-23(15-19)27-20-8-10-21(11-9-20)30-17-18-5-2-1-3-6-18/h1-15H,16-17H2,(H,25,27)(H,26,28) |
| InChIKey | HGSMLRCJCMHGQE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |