C25H22F3N3O2 — CID 21090708
2-[4-[1-(4-phenylmethoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]ethanamine (PubChem CID 21090708) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 2-[4-[1-(4-phenylmethoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]ethanamine.
| Compound Name | 2-[4-[1-(4-phenylmethoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 21090708 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[4-[1-(4-phenylmethoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]ethanamine |
| SMILES | NCCOc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H22F3N3O2/c26-25(27,28)24-16-23(19-6-10-21(11-7-19)32-15-14-29)31(30-24)20-8-12-22(13-9-20)33-17-18-4-2-1-3-5-18/h1-13,16H,14-15,17,29H2 |
| InChIKey | MLRBNNDSMUZDLI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |