C19H24N6O — CID 135367859
6-N-benzyl-2-N,2-N-dimethyl-9-(oxan-2-yl)purine-2,6-diamine (PubChem CID 135367859) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 6-N-benzyl-2-N,2-N-dimethyl-9-(oxan-2-yl)purine-2,6-diamine.
| Compound Name | 6-N-benzyl-2-N,2-N-dimethyl-9-(oxan-2-yl)purine-2,6-diamine |
|---|---|
| PubChem CID | 135367859 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 6-N-benzyl-2-N,2-N-dimethyl-9-(oxan-2-yl)purine-2,6-diamine |
| SMILES | CN(C)c1nc(NCc2ccccc2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C19H24N6O/c1-24(2)19-22-17(20-12-14-8-4-3-5-9-14)16-18(23-19)25(13-21-16)15-10-6-7-11-26-15/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3,(H,20,22,23) |
| InChIKey | XYORNBTXXUEAMM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |