C21H25N5OS — CID 101135603
6-benzylsulfanyl-9-(oxan-2-yl)-2-pyrrolidin-1-ylpurine (PubChem CID 101135603) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 6-benzylsulfanyl-9-(oxan-2-yl)-2-pyrrolidin-1-ylpurine.
| Compound Name | 6-benzylsulfanyl-9-(oxan-2-yl)-2-pyrrolidin-1-ylpurine |
|---|---|
| PubChem CID | 101135603 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 6-benzylsulfanyl-9-(oxan-2-yl)-2-pyrrolidin-1-ylpurine |
| SMILES | c1ccc(CSc2nc(N3CCCC3)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C21H25N5OS/c1-2-8-16(9-3-1)14-28-20-18-19(23-21(24-20)25-11-5-6-12-25)26(15-22-18)17-10-4-7-13-27-17/h1-3,8-9,15,17H,4-7,10-14H2 |
| InChIKey | WEDVSXIDPBYJMS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |