C23H29N5O3 — CID 71119321
[1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-2-yl]methanol (PubChem CID 71119321) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is [1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-2-yl]methanol.
| Compound Name | [1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 71119321 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-2-yl]methanol |
| SMILES | COc1ccc(-c2nc(N3CCCCC3CO)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C23H29N5O3/c1-30-18-10-8-16(9-11-18)20-21-22(28(15-24-21)19-7-3-5-13-31-19)26-23(25-20)27-12-4-2-6-17(27)14-29/h8-11,15,17,19,29H,2-7,12-14H2,1H3 |
| InChIKey | ACTBUOCJTOXZMW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |