C27H36N6O4 — CID 71135850
tert-butyl N-[1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-4-yl]carbamate (PubChem CID 71135850) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71135850 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | tert-butyl N-[1-[6-(4-methoxyphenyl)-9-(oxan-2-yl)purin-2-yl]piperidin-4-yl]carbamate |
| SMILES | COc1ccc(-c2nc(N3CCC(NC(=O)OC(C)(C)C)CC3)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C27H36N6O4/c1-27(2,3)37-26(34)29-19-12-14-32(15-13-19)25-30-22(18-8-10-20(35-4)11-9-18)23-24(31-25)33(17-28-23)21-7-5-6-16-36-21/h8-11,17,19,21H,5-7,12-16H2,1-4H3,(H,29,34) |
| InChIKey | BLZGVRAIPBFLCE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |