C31H39N7O6 — CID 89287964
tert-butyl 5-[6-[3-[ethyl(hydroxy)carbamoyl]-4-methoxyphenyl]-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 89287964) has the molecular formula C31H39N7O6 and a molecular weight of 605.70 g/mol. Its IUPAC name is tert-butyl 5-[6-[3-[ethyl(hydroxy)carbamoyl]-4-methoxyphenyl]-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[6-[3-[ethyl(hydroxy)carbamoyl]-4-methoxyphenyl]-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 89287964 |
| Molecular Formula | C31H39N7O6 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | tert-butyl 5-[6-[3-[ethyl(hydroxy)carbamoyl]-4-methoxyphenyl]-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CCN(O)C(=O)c1cc(-c2nc(N3C=C4CN(C(=O)OC(C)(C)C)CC4C3)nc3c2ncn3C2CCCCO2)ccc1OC |
| InChI | InChI=1S/C31H39N7O6/c1-6-38(41)28(39)22-13-19(10-11-23(22)42-5)25-26-27(37(18-32-26)24-9-7-8-12-43-24)34-29(33-25)35-14-20-16-36(17-21(20)15-35)30(40)44-31(2,3)4/h10-11,13-14,18,21,24,41H,6-9,12,15-17H2,1-5H3 |
| InChIKey | JVEMWPFTIWPXAC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|