C19H23ClN6O3 — CID 87465877
ethyl 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanoate (PubChem CID 87465877) has the molecular formula C19H23ClN6O3 and a molecular weight of 418.89 g/mol. Its IUPAC name is ethyl 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 87465877 |
| Molecular Formula | C19H23ClN6O3 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)n1cc(-c2nc(Cl)nc3c2ncn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C19H23ClN6O3/c1-4-28-17(27)19(2,3)26-10-12(9-22-26)14-15-16(24-18(20)23-14)25(11-21-15)13-7-5-6-8-29-13/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | XXEITYJARSPXIU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |