C17H20ClN7O2 — CID 87467925
2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanamide (PubChem CID 87467925) has the molecular formula C17H20ClN7O2 and a molecular weight of 389.85 g/mol. Its IUPAC name is 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanamide.
| Compound Name | 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 87467925 |
| Molecular Formula | C17H20ClN7O2 |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]pyrazol-1-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(N)=O)n1cc(-c2nc(Cl)nc3c2ncn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C17H20ClN7O2/c1-17(2,15(19)26)25-8-10(7-21-25)12-13-14(23-16(18)22-12)24(9-20-13)11-5-3-4-6-27-11/h7-9,11H,3-6H2,1-2H3,(H2,19,26) |
| InChIKey | DJGFJHZPPNLRHP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |