C19H20ClN5O3 — CID 87466958
[4-[2-chloro-9-(oxan-2-yl)purin-6-yl]phenyl] N-ethylcarbamate (PubChem CID 87466958) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is [4-[2-chloro-9-(oxan-2-yl)purin-6-yl]phenyl] N-ethylcarbamate.
| Compound Name | [4-[2-chloro-9-(oxan-2-yl)purin-6-yl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 87466958 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [4-[2-chloro-9-(oxan-2-yl)purin-6-yl]phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(-c2nc(Cl)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C19H20ClN5O3/c1-2-21-19(26)28-13-8-6-12(7-9-13)15-16-17(24-18(20)23-15)25(11-22-16)14-5-3-4-10-27-14/h6-9,11,14H,2-5,10H2,1H3,(H,21,26) |
| InChIKey | HMVZYJZPBGQFBQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |