C25H31N7O3 — CID 78030781
1-[6-(1-ethylbenzimidazol-5-yl)-9-(oxan-2-yl)purin-2-yl]-4-(hydroxymethyl)piperidin-3-ol (PubChem CID 78030781) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-[6-(1-ethylbenzimidazol-5-yl)-9-(oxan-2-yl)purin-2-yl]-4-(hydroxymethyl)piperidin-3-ol.
| Compound Name | 1-[6-(1-ethylbenzimidazol-5-yl)-9-(oxan-2-yl)purin-2-yl]-4-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 78030781 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[6-(1-ethylbenzimidazol-5-yl)-9-(oxan-2-yl)purin-2-yl]-4-(hydroxymethyl)piperidin-3-ol |
| SMILES | CCn1cnc2cc(-c3nc(N4CCC(CO)C(O)C4)nc4c3ncn4C3CCCCO3)ccc21 |
| InChI | InChI=1S/C25H31N7O3/c1-2-30-14-26-18-11-16(6-7-19(18)30)22-23-24(32(15-27-23)21-5-3-4-10-35-21)29-25(28-22)31-9-8-17(13-33)20(34)12-31/h6-7,11,14-15,17,20-21,33-34H,2-5,8-10,12-13H2,1H3 |
| InChIKey | JHDUGDYSBMXPOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |